C21H21N5OS — CID 135944997
6-[(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]-2-thiophen-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135944997) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is 6-[(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]-2-thiophen-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]-2-thiophen-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135944997 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 6-[(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)methyl]-2-thiophen-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(C)cccn2c1CN1CCc2nc(-c3cccs3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C21H21N5OS/c1-13-5-3-8-26-17(14(2)22-20(13)26)12-25-9-7-16-15(11-25)21(27)24-19(23-16)18-6-4-10-28-18/h3-6,8,10H,7,9,11-12H2,1-2H3,(H,23,24,27) |
| InChIKey | LTKUEBQTEWZFHY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |