C24H28N4O — CID 135945848
6-[[6-(2,3-dimethylphenyl)-3-pyridinyl]methyl]-2-propyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135945848) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 6-[[6-(2,3-dimethylphenyl)-3-pyridinyl]methyl]-2-propyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[6-(2,3-dimethylphenyl)-3-pyridinyl]methyl]-2-propyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135945848 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 6-[[6-(2,3-dimethylphenyl)-3-pyridinyl]methyl]-2-propyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCCc1nc2c(c(=O)[nH]1)CN(Cc1ccc(-c3cccc(C)c3C)nc1)CC2 |
| InChI | InChI=1S/C24H28N4O/c1-4-6-23-26-22-11-12-28(15-20(22)24(29)27-23)14-18-9-10-21(25-13-18)19-8-5-7-16(2)17(19)3/h5,7-10,13H,4,6,11-12,14-15H2,1-3H3,(H,26,27,29) |
| InChIKey | LGRQPFOJURPHAJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |