C24H23Cl2N5O — CID 135945964
6-[[6-(2,3-dichlorophenyl)-3-pyridinyl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135945964) has the molecular formula C24H23Cl2N5O and a molecular weight of 468.39 g/mol. Its IUPAC name is 6-[[6-(2,3-dichlorophenyl)-3-pyridinyl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[6-(2,3-dichlorophenyl)-3-pyridinyl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135945964 |
| Molecular Formula | C24H23Cl2N5O |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 6-[[6-(2,3-dichlorophenyl)-3-pyridinyl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2=NCCCC2)nc2c1CN(Cc1ccc(-c3cccc(Cl)c3Cl)nc1)CC2 |
| InChI | InChI=1S/C24H23Cl2N5O/c25-18-5-3-4-16(22(18)26)19-8-7-15(12-28-19)13-31-11-9-20-17(14-31)24(32)30-23(29-20)21-6-1-2-10-27-21/h3-5,7-8,12H,1-2,6,9-11,13-14H2,(H,29,30,32) |
| InChIKey | VKRJFGKVJNNARP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |