C26H28F3N5O2 — CID 135946294
6-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135946294) has the molecular formula C26H28F3N5O2 and a molecular weight of 499.54 g/mol. Its IUPAC name is 6-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135946294 |
| Molecular Formula | C26H28F3N5O2 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 6-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC1CN(c2ccc(CN3CCc4nc(-c5ccc(C(F)(F)F)cc5)[nH]c(=O)c4C3)cn2)CC(C)O1 |
| InChI | InChI=1S/C26H28F3N5O2/c1-16-12-34(13-17(2)36-16)23-8-3-18(11-30-23)14-33-10-9-22-21(15-33)25(35)32-24(31-22)19-4-6-20(7-5-19)26(27,28)29/h3-8,11,16-17H,9-10,12-15H2,1-2H3,(H,31,32,35) |
| InChIKey | PDMJINUSOQUPPO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |