C20H17Cl2F3N4O — CID 135946342
6-[[1-[(3,4-dichlorophenyl)methyl]pyrrol-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135946342) has the molecular formula C20H17Cl2F3N4O and a molecular weight of 457.28 g/mol. Its IUPAC name is 6-[[1-[(3,4-dichlorophenyl)methyl]pyrrol-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[1-[(3,4-dichlorophenyl)methyl]pyrrol-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135946342 |
| Molecular Formula | C20H17Cl2F3N4O |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 6-[[1-[(3,4-dichlorophenyl)methyl]pyrrol-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc2c1CN(Cc1cccn1Cc1ccc(Cl)c(Cl)c1)CC2 |
| InChI | InChI=1S/C20H17Cl2F3N4O/c21-15-4-3-12(8-16(15)22)9-29-6-1-2-13(29)10-28-7-5-17-14(11-28)18(30)27-19(26-17)20(23,24)25/h1-4,6,8H,5,7,9-11H2,(H,26,27,30) |
| InChIKey | OCDDDGXIUSWFLQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |