C26H36N4O2Si — CID 135946643
2-phenyl-6-[[2-tri(propan-2-yl)silyl-1,3-oxazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135946643) has the molecular formula C26H36N4O2Si and a molecular weight of 464.69 g/mol. Its IUPAC name is 2-phenyl-6-[[2-tri(propan-2-yl)silyl-1,3-oxazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-phenyl-6-[[2-tri(propan-2-yl)silyl-1,3-oxazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135946643 |
| Molecular Formula | C26H36N4O2Si |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 2-phenyl-6-[[2-tri(propan-2-yl)silyl-1,3-oxazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC(C)[Si](c1ncc(CN2CCc3nc(-c4ccccc4)[nH]c(=O)c3C2)o1)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H36N4O2Si/c1-17(2)33(18(3)4,19(5)6)26-27-14-21(32-26)15-30-13-12-23-22(16-30)25(31)29-24(28-23)20-10-8-7-9-11-20/h7-11,14,17-19H,12-13,15-16H2,1-6H3,(H,28,29,31) |
| InChIKey | NCTFENJCDBWBPY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|