C24H26N4OS — CID 135946944
6-[[5-(2-methylphenyl)thiophen-2-yl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135946944) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is 6-[[5-(2-methylphenyl)thiophen-2-yl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[5-(2-methylphenyl)thiophen-2-yl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135946944 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 6-[[5-(2-methylphenyl)thiophen-2-yl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1ccccc1-c1ccc(CN2CCc3nc(C4=NCCCC4)[nH]c(=O)c3C2)s1 |
| InChI | InChI=1S/C24H26N4OS/c1-16-6-2-3-7-18(16)22-10-9-17(30-22)14-28-13-11-20-19(15-28)24(29)27-23(26-20)21-8-4-5-12-25-21/h2-3,6-7,9-10H,4-5,8,11-15H2,1H3,(H,26,27,29) |
| InChIKey | XOIOOQQHXHCZIN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |