C16H17F3N4O2 — CID 135947412
2-methyl-6-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135947412) has the molecular formula C16H17F3N4O2 and a molecular weight of 354.33 g/mol. Its IUPAC name is 2-methyl-6-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-methyl-6-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135947412 |
| Molecular Formula | C16H17F3N4O2 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-methyl-6-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)CN(Cc1cccnc1OCC(F)(F)F)CC2 |
| InChI | InChI=1S/C16H17F3N4O2/c1-10-21-13-4-6-23(8-12(13)14(24)22-10)7-11-3-2-5-20-15(11)25-9-16(17,18)19/h2-3,5H,4,6-9H2,1H3,(H,21,22,24) |
| InChIKey | XVILJDPHUMWVHE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |