C20H22ClN5O — CID 135947709
2-(4-chlorophenyl)-6-[(1,4,5-trimethylimidazol-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135947709) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-[(1,4,5-trimethylimidazol-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-chlorophenyl)-6-[(1,4,5-trimethylimidazol-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135947709 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-(4-chlorophenyl)-6-[(1,4,5-trimethylimidazol-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nc(CN2CCc3nc(-c4ccc(Cl)cc4)[nH]c(=O)c3C2)n(C)c1C |
| InChI | InChI=1S/C20H22ClN5O/c1-12-13(2)25(3)18(22-12)11-26-9-8-17-16(10-26)20(27)24-19(23-17)14-4-6-15(21)7-5-14/h4-7H,8-11H2,1-3H3,(H,23,24,27) |
| InChIKey | JLIGVRDEXHVKAJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |