About 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one
4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 135949018) has the molecular formula C22H20Cl2N2O2S
and a molecular weight of 447.39 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one |
| PubChem CID | 135949018 |
| Molecular Formula | C22H20Cl2N2O2S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1c(Cc2c(Cl)cccc2Cl)nc(SCC(=O)c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C22H20Cl2N2O2S/c1-13(2)20-18(11-15-16(23)9-6-10-17(15)24)25-22(26-21(20)28)29-12-19(27)14-7-4-3-5-8-14/h3-10,13H,11-12H2,1-2H3,(H,25,26,28) |
| InChIKey | YKXRHFFWXMPWOR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one?
The IUPAC name of 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one (CID 135949018) is 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one?
The canonical SMILES for 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one is CC(C)c1c(Cc2c(Cl)cccc2Cl)nc(SCC(=O)c2ccccc2)[nH]c1=O.
What is the InChIKey of 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one?
The InChIKey is YKXRHFFWXMPWOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20Cl2N2O2S/c1-13(2)20-18(11-15-16(23)9-6-10-17(15)24)25-22(26-21(20)28)29-12-19(27)14-7-4-3-5-8-14/h3-10,13H,11-12H2,1-2H3,(H,25,26,28).
What are the key properties of 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one?
4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one has a molecular weight of 447.39 g/mol, XLogP of 5.77, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dichlorophenyl)methyl]-2-phenacylsulfanyl-5-propan-2-yl-1H-pyrimidin-6-one is sourced from PubChem (CID 135949018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).