C21H22FN5OS — CID 135950047
1-[5-fluoro-2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]imino-3-phenylthiourea (PubChem CID 135950047) has the molecular formula C21H22FN5OS and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[5-fluoro-2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]imino-3-phenylthiourea.
| Compound Name | 1-[5-fluoro-2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]imino-3-phenylthiourea |
|---|---|
| PubChem CID | 135950047 |
| Molecular Formula | C21H22FN5OS |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-[5-fluoro-2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]imino-3-phenylthiourea |
| SMILES | Oc1c(/N=N/C(=S)Nc2ccccc2)c2cc(F)ccc2n1CN1CCCCC1 |
| InChI | InChI=1S/C21H22FN5OS/c22-15-9-10-18-17(13-15)19(20(28)27(18)14-26-11-5-2-6-12-26)24-25-21(29)23-16-7-3-1-4-8-16/h1,3-4,7-10,13,28H,2,5-6,11-12,14H2,(H,23,29)/b25-24+ |
| InChIKey | GDSMADGCPXHGPS-OCOZRVBESA-N |
| XLogP | 5.41 |
| TPSA | 65.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|