C14H11Cl2N3O3S — CID 135950090
7-chloro-3-[(2-chlorophenyl)methylimino]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-ol (PubChem CID 135950090) has the molecular formula C14H11Cl2N3O3S and a molecular weight of 372.23 g/mol. Its IUPAC name is 7-chloro-3-[(2-chlorophenyl)methylimino]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-ol.
| Compound Name | 7-chloro-3-[(2-chlorophenyl)methylimino]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-ol |
|---|---|
| PubChem CID | 135950090 |
| Molecular Formula | C14H11Cl2N3O3S |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 7-chloro-3-[(2-chlorophenyl)methylimino]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-ol |
| SMILES | O=S1(=O)N/C(=N/Cc2ccccc2Cl)Nc2c(O)cc(Cl)cc21 |
| InChI | InChI=1S/C14H11Cl2N3O3S/c15-9-5-11(20)13-12(6-9)23(21,22)19-14(18-13)17-7-8-3-1-2-4-10(8)16/h1-6,20H,7H2,(H2,17,18,19) |
| InChIKey | IRWOIYOJJPHOJF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|