C17H26N4O4 — CID 135950227
tert-butyl 2-(2,2-dimethylpropanoylamino)-4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 135950227) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl 2-(2,2-dimethylpropanoylamino)-4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | tert-butyl 2-(2,2-dimethylpropanoylamino)-4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 135950227 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl 2-(2,2-dimethylpropanoylamino)-4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(nc(NC(=O)C(C)(C)C)[nH]c2=O)C1 |
| InChI | InChI=1S/C17H26N4O4/c1-16(2,3)13(23)20-14-18-11-9-21(15(24)25-17(4,5)6)8-7-10(11)12(22)19-14/h7-9H2,1-6H3,(H2,18,19,20,22,23) |
| InChIKey | BGJQIFRILOMXMU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |