About 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione
6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione (PubChem CID 135950386) has the molecular formula C20H20N2O5S
and a molecular weight of 400.46 g/mol. Its IUPAC name is 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione |
| PubChem CID | 135950386 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione |
| SMILES | COc1ccc(-c2cnc(=S)[nH]c2-c2c(O)cc(OC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C20H20N2O5S/c1-24-12-7-5-11(6-8-12)13-10-21-20(28)22-17(13)16-14(23)9-15(25-2)18(26-3)19(16)27-4/h5-10,23H,1-4H3,(H,21,22,28) |
| InChIKey | JICDJBPRDZVOLW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione?
The IUPAC name of 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione (CID 135950386) is 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione.
What is the SMILES notation for 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione?
The canonical SMILES for 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione is COc1ccc(-c2cnc(=S)[nH]c2-c2c(O)cc(OC)c(OC)c2OC)cc1.
What is the InChIKey of 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione?
The InChIKey is JICDJBPRDZVOLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O5S/c1-24-12-7-5-11(6-8-12)13-10-21-20(28)22-17(13)16-14(23)9-15(25-2)18(26-3)19(16)27-4/h5-10,23H,1-4H3,(H,21,22,28).
What are the key properties of 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione?
6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione has a molecular weight of 400.46 g/mol, XLogP of 4.21, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-hydroxy-2,3,4-trimethoxyphenyl)-5-(4-methoxyphenyl)-1H-pyrimidine-2-thione is sourced from PubChem (CID 135950386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).