C27H19N3O5S2 — CID 135950965
ethyl 3-[[(4Z)-4-(4-iminothieno[3,4-c]chromen-3-yl)iminothieno[3,4-c]chromen-3-yl]amino]-3-oxopropanoate (PubChem CID 135950965) has the molecular formula C27H19N3O5S2 and a molecular weight of 529.60 g/mol. Its IUPAC name is ethyl 3-[[(4Z)-4-(4-iminothieno[3,4-c]chromen-3-yl)iminothieno[3,4-c]chromen-3-yl]amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[[(4Z)-4-(4-iminothieno[3,4-c]chromen-3-yl)iminothieno[3,4-c]chromen-3-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 135950965 |
| Molecular Formula | C27H19N3O5S2 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | ethyl 3-[[(4Z)-4-(4-iminothieno[3,4-c]chromen-3-yl)iminothieno[3,4-c]chromen-3-yl]amino]-3-oxopropanoate |
| SMILES | [H]/N=c1\oc2ccccc2c2csc(/N=c3\oc4ccccc4c4csc(NC(=O)CC(=O)OCC)c34)c12 |
| InChI | InChI=1S/C27H19N3O5S2/c1-2-33-21(32)11-20(31)29-27-23-17(13-37-27)15-8-4-6-10-19(15)35-25(23)30-26-22-16(12-36-26)14-7-3-5-9-18(14)34-24(22)28/h3-10,12-13,28H,2,11H2,1H3,(H,29,31)/b28-24-,30-25- |
| InChIKey | YKBOVAZVGSKLLX-PQXJWCPHSA-N |
| XLogP | 6.21 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|