C40H13F15N4O3 — CID 135951012
(E)-[(17E,18E)-17,18-bis(hydroxymethylidene)-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-12,13-dihydrocorrin-3-ylidene]methanol (PubChem CID 135951012) has the molecular formula C40H13F15N4O3 and a molecular weight of 882.54 g/mol. Its IUPAC name is (E)-[(17E,18E)-17,18-bis(hydroxymethylidene)-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-12,13-dihydrocorrin-3-ylidene]methanol.
| Compound Name | (E)-[(17E,18E)-17,18-bis(hydroxymethylidene)-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-12,13-dihydrocorrin-3-ylidene]methanol |
|---|---|
| PubChem CID | 135951012 |
| Molecular Formula | C40H13F15N4O3 |
| Molecular Weight | 882.54 g/mol |
| Exact Mass | 882.07 |
| IUPAC Name | (E)-[(17E,18E)-17,18-bis(hydroxymethylidene)-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-12,13-dihydrocorrin-3-ylidene]methanol |
| SMILES | O/C=C1\C=C2N=C1/C(c1c(F)c(F)c(F)c(F)c1F)=C1/C=CC(=N1)/C(c1c(F)c(F)c(F)c(F)c1F)=C1/CCC(=N1)/C(c1c(F)c(F)c(F)c(F)c1F)=C1\N=C2C(=C/O)/C1=C\O |
| InChI | InChI=1S/C40H13F15N4O3/c41-23-20(24(42)30(48)35(53)29(23)47)17-12-1-3-14(56-12)18(21-25(43)31(49)36(54)32(50)26(21)44)38-9(6-60)5-16(58-38)39-10(7-61)11(8-62)40(59-39)19(15-4-2-13(17)57-15)22-27(45)33(51)37(55)34(52)28(22)46/h1,3,5-8,60-62H,2,4H2/b9-6+,10-7+,11-8+,17-13+,18-14-,40-19+ |
| InChIKey | MYHAMSHMLMXMFC-OHAURHABSA-N |
| XLogP | 10.68 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.54 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|