C24H20N4O2 — CID 135951785
1-benzyl-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-phenylpyrazole-5-carboxamide (PubChem CID 135951785) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-benzyl-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-phenylpyrazole-5-carboxamide.
| Compound Name | 1-benzyl-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135951785 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-benzyl-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-phenylpyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1O)c1cc(-c2ccccc2)nn1Cc1ccccc1 |
| InChI | InChI=1S/C24H20N4O2/c29-23-14-8-7-13-20(23)16-25-26-24(30)22-15-21(19-11-5-2-6-12-19)27-28(22)17-18-9-3-1-4-10-18/h1-16,29H,17H2,(H,26,30)/b25-16+ |
| InChIKey | AQLWGBDGVJNVBC-PCLIKHOPSA-N |
| XLogP | 4.07 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|