C17H12N4O3 — CID 135952265
3-(4-methoxyphenyl)-7H-[1,2,4]triazino[4,3-c]quinazoline-4,6-dione (PubChem CID 135952265) has the molecular formula C17H12N4O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-7H-[1,2,4]triazino[4,3-c]quinazoline-4,6-dione.
| Compound Name | 3-(4-methoxyphenyl)-7H-[1,2,4]triazino[4,3-c]quinazoline-4,6-dione |
|---|---|
| PubChem CID | 135952265 |
| Molecular Formula | C17H12N4O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-7H-[1,2,4]triazino[4,3-c]quinazoline-4,6-dione |
| SMILES | COc1ccc(-c2nnc3c4ccccc4[nH]c(=O)n3c2=O)cc1 |
| InChI | InChI=1S/C17H12N4O3/c1-24-11-8-6-10(7-9-11)14-16(22)21-15(20-19-14)12-4-2-3-5-13(12)18-17(21)23/h2-9H,1H3,(H,18,23) |
| InChIKey | JNUFFLGMMFFNOB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|