C32H44FeN6O4+3 — CID 135952370
4-hydroxy-3-[2-[[2-hydroxy-5-[methyl-(1-methylpiperidin-4-yl)carbamoyl]phenyl]methylideneamino]ethyliminomethyl]-N-methyl-N-(1-methylpiperidin-4-yl)benzamide;iron(3+) (PubChem CID 135952370) has the molecular formula C32H44FeN6O4+3 and a molecular weight of 632.59 g/mol. Its IUPAC name is 4-hydroxy-3-[2-[[2-hydroxy-5-[methyl-(1-methylpiperidin-4-yl)carbamoyl]phenyl]methylideneamino]ethyliminomethyl]-N-methyl-N-(1-methylpiperidin-4-yl)benzamide;iron(3+).
| Compound Name | 4-hydroxy-3-[2-[[2-hydroxy-5-[methyl-(1-methylpiperidin-4-yl)carbamoyl]phenyl]methylideneamino]ethyliminomethyl]-N-methyl-N-(1-methylpiperidin-4-yl)benzamide;iron(3+) |
|---|---|
| PubChem CID | 135952370 |
| Molecular Formula | C32H44FeN6O4+3 |
| Molecular Weight | 632.59 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 4-hydroxy-3-[2-[[2-hydroxy-5-[methyl-(1-methylpiperidin-4-yl)carbamoyl]phenyl]methylideneamino]ethyliminomethyl]-N-methyl-N-(1-methylpiperidin-4-yl)benzamide;iron(3+) |
| SMILES | CN1CCC(N(C)C(=O)c2ccc(O)c(/C=N/CC/N=C/c3cc(C(=O)N(C)C4CCN(C)CC4)ccc3O)c2)CC1.[Fe+3] |
| InChI | InChI=1S/C32H44N6O4.Fe/c1-35-15-9-27(10-16-35)37(3)31(41)23-5-7-29(39)25(19-23)21-33-13-14-34-22-26-20-24(6-8-30(26)40)32(42)38(4)28-11-17-36(2)18-12-28;/h5-8,19-22,27-28,39-40H,9-18H2,1-4H3;/q;+3/b33-21+,34-22+; |
| InChIKey | GGYBKWOPODHUBK-KECHZXEWSA-N |
| XLogP | 2.97 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.59 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|