C13H16O2 — CID 135952392
1-[(2S,3S)-3-phenyl(118O)oxiran-2-yl]pentan-1-one (PubChem CID 135952392) has the molecular formula C13H16O2 and a molecular weight of 206.27 g/mol. Its IUPAC name is 1-[(2S,3S)-3-phenyl(118O)oxiran-2-yl]pentan-1-one.
| Compound Name | 1-[(2S,3S)-3-phenyl(118O)oxiran-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 135952392 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1-[(2S,3S)-3-phenyl(118O)oxiran-2-yl]pentan-1-one |
| SMILES | CCCCC(=O)[C@H]1[18O][C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-2-3-9-11(14)13-12(15-13)10-7-5-4-6-8-10/h4-8,12-13H,2-3,9H2,1H3/t12-,13+/m0/s1/i15+2 |
| InChIKey | FBUQFACZLBLLRN-VDHCOQFTSA-N |
| XLogP | 2.89 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|