C19H16F3N5O2 — CID 135952919
13-[4-(trifluoromethyl)phenyl]-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine (PubChem CID 135952919) has the molecular formula C19H16F3N5O2 and a molecular weight of 403.36 g/mol. Its IUPAC name is 13-[4-(trifluoromethyl)phenyl]-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine.
| Compound Name | 13-[4-(trifluoromethyl)phenyl]-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine |
|---|---|
| PubChem CID | 135952919 |
| Molecular Formula | C19H16F3N5O2 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 13-[4-(trifluoromethyl)phenyl]-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine |
| SMILES | NC1=NC(c2ccc(C(F)(F)F)cc2)n2c(nc3cc4c(cc32)OCCCO4)N1 |
| InChI | InChI=1S/C19H16F3N5O2/c20-19(21,22)11-4-2-10(3-5-11)16-25-17(23)26-18-24-12-8-14-15(9-13(12)27(16)18)29-7-1-6-28-14/h2-5,8-9,16H,1,6-7H2,(H3,23,24,25,26) |
| InChIKey | QQASYOOAIWGHJB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |