C19H18N6O4 — CID 135952943
13-(4-methyl-3-nitrophenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine (PubChem CID 135952943) has the molecular formula C19H18N6O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is 13-(4-methyl-3-nitrophenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine.
| Compound Name | 13-(4-methyl-3-nitrophenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine |
|---|---|
| PubChem CID | 135952943 |
| Molecular Formula | C19H18N6O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 13-(4-methyl-3-nitrophenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine |
| SMILES | Cc1ccc(C2N=C(N)Nc3nc4cc5c(cc4n32)OCCCO5)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N6O4/c1-10-3-4-11(7-13(10)25(26)27)17-22-18(20)23-19-21-12-8-15-16(9-14(12)24(17)19)29-6-2-5-28-15/h3-4,7-9,17H,2,5-6H2,1H3,(H3,20,21,22,23) |
| InChIKey | JKHXEOBBOYZJQQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|