C19H19N5O5 — CID 135952945
5-(15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl)-3-methoxybenzene-1,2-diol (PubChem CID 135952945) has the molecular formula C19H19N5O5 and a molecular weight of 397.39 g/mol. Its IUPAC name is 5-(15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl)-3-methoxybenzene-1,2-diol.
| Compound Name | 5-(15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl)-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 135952945 |
| Molecular Formula | C19H19N5O5 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 5-(15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl)-3-methoxybenzene-1,2-diol |
| SMILES | COc1cc(C2N=C(N)Nc3nc4cc5c(cc4n32)OCCCO5)cc(O)c1O |
| InChI | InChI=1S/C19H19N5O5/c1-27-15-6-9(5-12(25)16(15)26)17-22-18(20)23-19-21-10-7-13-14(8-11(10)24(17)19)29-4-2-3-28-13/h5-8,17,25-26H,2-4H2,1H3,(H3,20,21,22,23) |
| InChIKey | CISXYJMLZZDTLA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|