C25H39N3O2 — CID 135953357
4-[5-[(Z)-heptadec-8-enyl]-1H-1,2,4-triazol-3-yl]benzene-1,2-diol (PubChem CID 135953357) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 4-[5-[(Z)-heptadec-8-enyl]-1H-1,2,4-triazol-3-yl]benzene-1,2-diol.
| Compound Name | 4-[5-[(Z)-heptadec-8-enyl]-1H-1,2,4-triazol-3-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135953357 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | 4-[5-[(Z)-heptadec-8-enyl]-1H-1,2,4-triazol-3-yl]benzene-1,2-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCc1nc(-c2ccc(O)c(O)c2)n[nH]1 |
| InChI | InChI=1S/C25H39N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24-26-25(28-27-24)21-18-19-22(29)23(30)20-21/h9-10,18-20,29-30H,2-8,11-17H2,1H3,(H,26,27,28)/b10-9- |
| InChIKey | XOJBOANYHHDMKW-KTKRTIGZSA-N |
| XLogP | 7.07 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|