C17H22N6O3 — CID 135954167
N-cyclopentyl-N'-[2-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]oxamide (PubChem CID 135954167) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-cyclopentyl-N'-[2-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]oxamide.
| Compound Name | N-cyclopentyl-N'-[2-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]oxamide |
|---|---|
| PubChem CID | 135954167 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-cyclopentyl-N'-[2-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NC2CCCC2)n(-c2nc(C)c(C)c(=O)[nH]2)n1 |
| InChI | InChI=1S/C17H22N6O3/c1-9-8-13(20-16(26)15(25)19-12-6-4-5-7-12)23(22-9)17-18-11(3)10(2)14(24)21-17/h8,12H,4-7H2,1-3H3,(H,19,25)(H,20,26)(H,18,21,24) |
| InChIKey | BUDTWINWNNYSNC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|