C18H15F2N5O3 — CID 135954369
(7S)-7-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135954369) has the molecular formula C18H15F2N5O3 and a molecular weight of 387.35 g/mol. Its IUPAC name is (7S)-7-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-7-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135954369 |
| Molecular Formula | C18H15F2N5O3 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (7S)-7-[5-[(2,4-difluorophenoxy)methyl]furan-2-yl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(N)=O)[C@@H](c2ccc(COc3ccc(F)cc3F)o2)n2ncnc2N1 |
| InChI | InChI=1S/C18H15F2N5O3/c1-9-15(17(21)26)16(25-18(24-9)22-8-23-25)14-5-3-11(28-14)7-27-13-4-2-10(19)6-12(13)20/h2-6,8,16H,7H2,1H3,(H2,21,26)(H,22,23,24)/t16-/m1/s1 |
| InChIKey | IYNKHLITEMYQPT-MRXNPFEDSA-N |
| XLogP | 2.50 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |