C12H14BrFN6O — CID 135955170
2-bromo-4-(5-fluoropentyl)-8-methyl-1H-[1,2,4]triazolo[5,1-f]purin-5-one (PubChem CID 135955170) has the molecular formula C12H14BrFN6O and a molecular weight of 357.19 g/mol. Its IUPAC name is 2-bromo-4-(5-fluoropentyl)-8-methyl-1H-[1,2,4]triazolo[5,1-f]purin-5-one.
| Compound Name | 2-bromo-4-(5-fluoropentyl)-8-methyl-1H-[1,2,4]triazolo[5,1-f]purin-5-one |
|---|---|
| PubChem CID | 135955170 |
| Molecular Formula | C12H14BrFN6O |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-bromo-4-(5-fluoropentyl)-8-methyl-1H-[1,2,4]triazolo[5,1-f]purin-5-one |
| SMILES | Cc1nc2c3[nH]c(Br)nc3n(CCCCCF)c(=O)n2n1 |
| InChI | InChI=1S/C12H14BrFN6O/c1-7-15-10-8-9(17-11(13)16-8)19(6-4-2-3-5-14)12(21)20(10)18-7/h2-6H2,1H3,(H,16,17) |
| InChIKey | SIPNKPKYXQASMS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|