C19H19N3O2 — CID 135955779
10-[2-(4-methoxyphenyl)ethylamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol (PubChem CID 135955779) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 10-[2-(4-methoxyphenyl)ethylamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol.
| Compound Name | 10-[2-(4-methoxyphenyl)ethylamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol |
|---|---|
| PubChem CID | 135955779 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 10-[2-(4-methoxyphenyl)ethylamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol |
| SMILES | COc1ccc(CCNc2cc3c4c(c2O)N=CC=4CCN=3)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-24-14-4-2-12(3-5-14)6-8-21-16-10-15-17-13(7-9-20-15)11-22-18(17)19(16)23/h2-5,10-11,21,23H,6-9H2,1H3 |
| InChIKey | KGYLGWRLHJYOOO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|