C19H19N3O3 — CID 135955797
10-[(3,4-dimethoxyphenyl)methylamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol (PubChem CID 135955797) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 10-[(3,4-dimethoxyphenyl)methylamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol.
| Compound Name | 10-[(3,4-dimethoxyphenyl)methylamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol |
|---|---|
| PubChem CID | 135955797 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 10-[(3,4-dimethoxyphenyl)methylamino]-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol |
| SMILES | COc1ccc(CNc2cc3c4c(c2O)N=CC=4CCN=3)cc1OC |
| InChI | InChI=1S/C19H19N3O3/c1-24-15-4-3-11(7-16(15)25-2)9-21-14-8-13-17-12(5-6-20-13)10-22-18(17)19(14)23/h3-4,7-8,10,21,23H,5-6,9H2,1-2H3 |
| InChIKey | GOWIKRVMNPKRQC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|