C28H32O7 — CID 135955994
3,5,9-trihydroxy-2,2-dimethyl-11,11-bis(3-methylbut-2-enyl)-3,4-dihydropyrano[2,3-a]xanthene-10,12-dione (PubChem CID 135955994) has the molecular formula C28H32O7 and a molecular weight of 480.56 g/mol. Its IUPAC name is 3,5,9-trihydroxy-2,2-dimethyl-11,11-bis(3-methylbut-2-enyl)-3,4-dihydropyrano[2,3-a]xanthene-10,12-dione.
| Compound Name | 3,5,9-trihydroxy-2,2-dimethyl-11,11-bis(3-methylbut-2-enyl)-3,4-dihydropyrano[2,3-a]xanthene-10,12-dione |
|---|---|
| PubChem CID | 135955994 |
| Molecular Formula | C28H32O7 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 3,5,9-trihydroxy-2,2-dimethyl-11,11-bis(3-methylbut-2-enyl)-3,4-dihydropyrano[2,3-a]xanthene-10,12-dione |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)C(O)=Cc2oc3cc(O)c4c(c3c(=O)c21)OC(C)(C)C(O)C4 |
| InChI | InChI=1S/C28H32O7/c1-14(2)7-9-28(10-8-15(3)4)23-20(13-18(30)26(28)33)34-19-12-17(29)16-11-21(31)27(5,6)35-25(16)22(19)24(23)32/h7-8,12-13,21,29-31H,9-11H2,1-6H3 |
| InChIKey | DGXWRPLNNOCAPN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|