About N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide
N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide (PubChem CID 135958368) has the molecular formula C19H16FN3O3
and a molecular weight of 353.35 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide |
| PubChem CID | 135958368 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide |
| SMILES | COc1cccc2c1nc1n2CCC(O)=C1C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C19H16FN3O3/c1-26-15-8-4-7-13-17(15)22-18-16(14(24)9-10-23(13)18)19(25)21-12-6-3-2-5-11(12)20/h2-8,24H,9-10H2,1H3,(H,21,25) |
| InChIKey | KKDHGZMFZLFGLX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide?
The IUPAC name of N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide (CID 135958368) is N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide.
What is the SMILES notation for N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide?
The canonical SMILES for N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide is COc1cccc2c1nc1n2CCC(O)=C1C(=O)Nc1ccccc1F.
What is the InChIKey of N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide?
The InChIKey is KKDHGZMFZLFGLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16FN3O3/c1-26-15-8-4-7-13-17(15)22-18-16(14(24)9-10-23(13)18)19(25)21-12-6-3-2-5-11(12)20/h2-8,24H,9-10H2,1H3,(H,21,25).
What are the key properties of N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide?
N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide has a molecular weight of 353.35 g/mol, XLogP of 3.50, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-3-hydroxy-6-methoxy-1,2-dihydropyrido[1,2-a]benzimidazole-4-carboxamide is sourced from PubChem (CID 135958368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).