C22H21N3O3 — CID 135958384
N-[15-[2-(dimethylamino)ethyl]-14-hydroxy-16-oxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaen-8-ylidene]acetamide (PubChem CID 135958384) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[15-[2-(dimethylamino)ethyl]-14-hydroxy-16-oxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaen-8-ylidene]acetamide.
| Compound Name | N-[15-[2-(dimethylamino)ethyl]-14-hydroxy-16-oxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaen-8-ylidene]acetamide |
|---|---|
| PubChem CID | 135958384 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[15-[2-(dimethylamino)ethyl]-14-hydroxy-16-oxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaen-8-ylidene]acetamide |
| SMILES | CC(=O)/N=C1\c2ccccc2-c2c(=O)n(CCN(C)C)c(O)c3cccc1c23 |
| InChI | InChI=1S/C22H21N3O3/c1-13(26)23-20-15-8-5-4-7-14(15)19-18-16(20)9-6-10-17(18)21(27)25(22(19)28)12-11-24(2)3/h4-10,27H,11-12H2,1-3H3/b23-20+ |
| InChIKey | AEPOOEPBRMCWOX-BSYVCWPDSA-N |
| XLogP | 2.63 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|