C19H21N5OS — CID 135958917
(5S,6R,7R)-N-(2,4-dimethylphenyl)-5-methyl-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135958917) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is (5S,6R,7R)-N-(2,4-dimethylphenyl)-5-methyl-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (5S,6R,7R)-N-(2,4-dimethylphenyl)-5-methyl-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135958917 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (5S,6R,7R)-N-(2,4-dimethylphenyl)-5-methyl-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2[C@H](C)Nc3ncnn3[C@H]2c2cccs2)c(C)c1 |
| InChI | InChI=1S/C19H21N5OS/c1-11-6-7-14(12(2)9-11)23-18(25)16-13(3)22-19-20-10-21-24(19)17(16)15-5-4-8-26-15/h4-10,13,16-17H,1-3H3,(H,23,25)(H,20,21,22)/t13-,16+,17-/m0/s1 |
| InChIKey | AVSIXKSRHTWGDQ-XKQJLSEDSA-N |
| XLogP | 3.61 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |