C32H35N6O9P — CID 135958975
[(1S)-1-phenylethyl] (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 135958975) has the molecular formula C32H35N6O9P and a molecular weight of 678.64 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | [(1S)-1-phenylethyl] (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 135958975 |
| Molecular Formula | C32H35N6O9P |
| Molecular Weight | 678.64 g/mol |
| Exact Mass | 678.22 |
| IUPAC Name | [(1S)-1-phenylethyl] (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@](C)(O)[C@@H]1O)Oc1cccc2ccccc12)C(=O)O[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C32H35N6O9P/c1-18(29(41)45-19(2)20-10-5-4-6-11-20)37-48(43,47-23-15-9-13-21-12-7-8-14-22(21)23)44-16-24-26(39)32(3,42)30(46-24)38-17-34-25-27(38)35-31(33)36-28(25)40/h4-15,17-19,24,26,30,39,42H,16H2,1-3H3,(H,37,43)(H3,33,35,36,40)/t18-,19-,24+,26+,30+,32+,48?/m0/s1 |
| InChIKey | LKONSCZRNCTDOM-ZHEYYNJZSA-N |
| XLogP | 3.35 |
| TPSA | 213.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.64 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|