C18H11F6IN2O2 — CID 135959016
(NE)-N-[[2-iodo-4-[5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazol-3-yl]phenyl]methylidene]hydroxylamine (PubChem CID 135959016) has the molecular formula C18H11F6IN2O2 and a molecular weight of 528.19 g/mol. Its IUPAC name is (NE)-N-[[2-iodo-4-[5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazol-3-yl]phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[2-iodo-4-[5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazol-3-yl]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135959016 |
| Molecular Formula | C18H11F6IN2O2 |
| Molecular Weight | 528.19 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | (NE)-N-[[2-iodo-4-[5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazol-3-yl]phenyl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1ccc(C2=NOC(c3cccc(C(F)(F)F)c3)(C(F)(F)F)C2)cc1I |
| InChI | InChI=1S/C18H11F6IN2O2/c19-17(20,21)13-3-1-2-12(7-13)16(18(22,23)24)8-15(27-29-16)10-4-5-11(9-26-28)14(25)6-10/h1-7,9,28H,8H2/b26-9+ |
| InChIKey | DENAYGWWDPTGHX-JQAMDZJQSA-N |
| XLogP | 5.70 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.19 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|