C25H25FN4O7S2 — CID 135959832
N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-6,9-dihydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 135959832) has the molecular formula C25H25FN4O7S2 and a molecular weight of 576.63 g/mol. Its IUPAC name is N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-6,9-dihydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-6,9-dihydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 135959832 |
| Molecular Formula | C25H25FN4O7S2 |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-6,9-dihydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1=C(O)[C@H]3[C@H]([C@H]4CC(O)[C@H]3C4)N(Cc3ccc(F)cc3)C1=O)N2 |
| InChI | InChI=1S/C25H25FN4O7S2/c1-38(34,35)28-15-6-7-17-19(10-15)39(36,37)29-24(27-17)21-23(32)20-16-8-13(9-18(16)31)22(20)30(25(21)33)11-12-2-4-14(26)5-3-12/h2-7,10,13,16,18,20,22,28,31-32H,8-9,11H2,1H3,(H,27,29)/t13-,16-,18?,20-,22+/m1/s1 |
| InChIKey | TXSXCITUUSJZHB-MFGHSMNLSA-N |
| XLogP | 1.95 |
| TPSA | 165.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |