C15H11F3N2O4 — CID 135959938
2-hydroxy-N-[(E)-[2-hydroxy-5-(trifluoromethoxy)phenyl]methylideneamino]benzamide (PubChem CID 135959938) has the molecular formula C15H11F3N2O4 and a molecular weight of 340.26 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-[2-hydroxy-5-(trifluoromethoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 2-hydroxy-N-[(E)-[2-hydroxy-5-(trifluoromethoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135959938 |
| Molecular Formula | C15H11F3N2O4 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-hydroxy-N-[(E)-[2-hydroxy-5-(trifluoromethoxy)phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc(OC(F)(F)F)ccc1O)c1ccccc1O |
| InChI | InChI=1S/C15H11F3N2O4/c16-15(17,18)24-10-5-6-12(21)9(7-10)8-19-20-14(23)11-3-1-2-4-13(11)22/h1-8,21-22H,(H,20,23)/b19-8+ |
| InChIKey | QYJJYEYSPIFJPJ-UFWORHAWSA-N |
| XLogP | 2.76 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|