C12H15N5O3 — CID 135960394
6-(3,4-dihydroxyphenyl)-4-(2-ethylhydrazinyl)-1-methyl-1,3,5-triazin-2-one (PubChem CID 135960394) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 6-(3,4-dihydroxyphenyl)-4-(2-ethylhydrazinyl)-1-methyl-1,3,5-triazin-2-one.
| Compound Name | 6-(3,4-dihydroxyphenyl)-4-(2-ethylhydrazinyl)-1-methyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135960394 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 6-(3,4-dihydroxyphenyl)-4-(2-ethylhydrazinyl)-1-methyl-1,3,5-triazin-2-one |
| SMILES | CCNNc1nc(-c2ccc(O)c(O)c2)n(C)c(=O)n1 |
| InChI | InChI=1S/C12H15N5O3/c1-3-13-16-11-14-10(17(2)12(20)15-11)7-4-5-8(18)9(19)6-7/h4-6,13,18-19H,3H2,1-2H3,(H,15,16,20) |
| InChIKey | MDRFDXUXVSUUCY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|