C20H16N4 — CID 135960442
1,2,3,22-tetrahydroporphyrin (PubChem CID 135960442) has the molecular formula C20H16N4 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1,2,3,22-tetrahydroporphyrin.
| Compound Name | 1,2,3,22-tetrahydroporphyrin |
|---|---|
| PubChem CID | 135960442 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1,2,3,22-tetrahydroporphyrin |
| SMILES | C1=CC2=NC1=CC1CCC(=N1)C=c1ccc([nH]1)=CC1=NC(=C2)C=C1 |
| InChI | InChI=1S/C20H16N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-6,9-12,19,23H,7-8H2 |
| InChIKey | BYQGJUILSOSNSK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |