C18H18N4O2S — CID 135960467
2-(4-methyl-6-oxo-2-pyridin-2-yl-1H-pyrimidin-5-yl)-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 135960467) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-(4-methyl-6-oxo-2-pyridin-2-yl-1H-pyrimidin-5-yl)-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(4-methyl-6-oxo-2-pyridin-2-yl-1H-pyrimidin-5-yl)-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 135960467 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-(4-methyl-6-oxo-2-pyridin-2-yl-1H-pyrimidin-5-yl)-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | Cc1nc(-c2ccccn2)[nH]c(=O)c1CC(=O)NC(C)c1cccs1 |
| InChI | InChI=1S/C18H18N4O2S/c1-11-13(10-16(23)20-12(2)15-7-5-9-25-15)18(24)22-17(21-11)14-6-3-4-8-19-14/h3-9,12H,10H2,1-2H3,(H,20,23)(H,21,22,24) |
| InChIKey | PMRRCLKOJQQSFB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |