C22H26N2O3 — CID 135960605
5-[(4aR,10bR)-8,9-diethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-1H-pyridin-2-one (PubChem CID 135960605) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 5-[(4aR,10bR)-8,9-diethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-1H-pyridin-2-one.
| Compound Name | 5-[(4aR,10bR)-8,9-diethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 135960605 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 5-[(4aR,10bR)-8,9-diethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-1H-pyridin-2-one |
| SMILES | CCOc1cc2c(cc1OCC)[C@H]1CCCC[C@H]1N=C2c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C22H26N2O3/c1-3-26-19-11-16-15-7-5-6-8-18(15)24-22(14-9-10-21(25)23-13-14)17(16)12-20(19)27-4-2/h9-13,15,18H,3-8H2,1-2H3,(H,23,25)/t15-,18-/m1/s1 |
| InChIKey | AEZTYHLSQITLDK-CRAIPNDOSA-N |
| XLogP | 4.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |