C21H17F2N6O2+ — CID 135960661
N-[N'-[4-(4aH-pyrrolo[2,1-f][1,2,4]triazin-8-ium-4-yloxy)-3-fluorophenyl]carbamimidoyl]-2-(4-fluorophenyl)acetamide (PubChem CID 135960661) has the molecular formula C21H17F2N6O2+ and a molecular weight of 423.40 g/mol. Its IUPAC name is N-[N'-[4-(4aH-pyrrolo[2,1-f][1,2,4]triazin-8-ium-4-yloxy)-3-fluorophenyl]carbamimidoyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[N'-[4-(4aH-pyrrolo[2,1-f][1,2,4]triazin-8-ium-4-yloxy)-3-fluorophenyl]carbamimidoyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 135960661 |
| Molecular Formula | C21H17F2N6O2+ |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[N'-[4-(4aH-pyrrolo[2,1-f][1,2,4]triazin-8-ium-4-yloxy)-3-fluorophenyl]carbamimidoyl]-2-(4-fluorophenyl)acetamide |
| SMILES | N/C(=N\c1ccc(OC2=NC=N[N+]3=CC=CC23)c(F)c1)NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H16F2N6O2/c22-14-5-3-13(4-6-14)10-19(30)28-21(24)27-15-7-8-18(16(23)11-15)31-20-17-2-1-9-29(17)26-12-25-20/h1-9,11-12,17H,10H2,(H2-,24,27,28,30)/p+1 |
| InChIKey | XXECDFOUTNPIOC-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|