C46H34N4O5 — CID 135960763
3-[10-[3-(2-hydroxyethoxy)phenyl]-15-(3-hydroxyphenyl)-20-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 135960763) has the molecular formula C46H34N4O5 and a molecular weight of 722.80 g/mol. Its IUPAC name is 3-[10-[3-(2-hydroxyethoxy)phenyl]-15-(3-hydroxyphenyl)-20-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 3-[10-[3-(2-hydroxyethoxy)phenyl]-15-(3-hydroxyphenyl)-20-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 135960763 |
| Molecular Formula | C46H34N4O5 |
| Molecular Weight | 722.80 g/mol |
| Exact Mass | 722.25 |
| IUPAC Name | 3-[10-[3-(2-hydroxyethoxy)phenyl]-15-(3-hydroxyphenyl)-20-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | OCCOc1cccc(-c2c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c(-c4ccc(O)cc4)c4nc(c(-c5cccc(O)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C46H34N4O5/c51-22-23-55-34-9-3-6-30(26-34)46-41-20-18-39(49-41)44(28-4-1-7-32(53)24-28)37-16-14-35(47-37)43(27-10-12-31(52)13-11-27)36-15-17-38(48-36)45(40-19-21-42(46)50-40)29-5-2-8-33(54)25-29/h1-21,24-26,47,50-54H,22-23H2/b43-35-,43-36-,44-37-,44-39-,45-38-,45-40-,46-41-,46-42- |
| InChIKey | MUPGZFBGTPIZMX-CRLDETFASA-N |
| XLogP | 9.81 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.80 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |