C48H38N4O6 — CID 135960764
3-[15,20-bis[3-(2-hydroxyethoxy)phenyl]-10-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 135960764) has the molecular formula C48H38N4O6 and a molecular weight of 766.85 g/mol. Its IUPAC name is 3-[15,20-bis[3-(2-hydroxyethoxy)phenyl]-10-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 3-[15,20-bis[3-(2-hydroxyethoxy)phenyl]-10-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 135960764 |
| Molecular Formula | C48H38N4O6 |
| Molecular Weight | 766.85 g/mol |
| Exact Mass | 766.28 |
| IUPAC Name | 3-[15,20-bis[3-(2-hydroxyethoxy)phenyl]-10-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | OCCOc1cccc(-c2c3nc(c(-c4cccc(OCCO)c4)c4ccc([nH]4)c(-c4cccc(O)c4)c4nc(c(-c5ccc(O)cc5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C48H38N4O6/c53-22-24-57-35-8-2-5-31(27-35)47-41-17-15-38(50-41)45(29-10-12-33(55)13-11-29)37-14-16-39(49-37)46(30-4-1-7-34(56)26-30)40-18-19-42(51-40)48(44-21-20-43(47)52-44)32-6-3-9-36(28-32)58-25-23-54/h1-21,26-28,50-51,53-56H,22-25H2/b45-37-,45-38-,46-39-,46-40-,47-41-,47-43-,48-42-,48-44- |
| InChIKey | VUHYBJAFZVJZJB-ZNSTUQKDSA-N |
| XLogP | 9.48 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.85 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |