C50H42N4O7 — CID 135960765
3-[15,20-bis[3-(2-hydroxyethoxy)phenyl]-10-[4-(2-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 135960765) has the molecular formula C50H42N4O7 and a molecular weight of 810.91 g/mol. Its IUPAC name is 3-[15,20-bis[3-(2-hydroxyethoxy)phenyl]-10-[4-(2-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 3-[15,20-bis[3-(2-hydroxyethoxy)phenyl]-10-[4-(2-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 135960765 |
| Molecular Formula | C50H42N4O7 |
| Molecular Weight | 810.91 g/mol |
| Exact Mass | 810.31 |
| IUPAC Name | 3-[15,20-bis[3-(2-hydroxyethoxy)phenyl]-10-[4-(2-hydroxyethoxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | OCCOc1ccc(-c2c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c(-c4cccc(OCCO)c4)c4nc(c(-c5cccc(OCCO)c5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C50H42N4O7/c55-22-25-59-36-12-10-31(11-13-36)47-39-14-16-41(51-39)48(32-4-1-7-35(58)28-32)42-18-19-44(53-42)50(34-6-3-9-38(30-34)61-27-24-57)46-21-20-45(54-46)49(43-17-15-40(47)52-43)33-5-2-8-37(29-33)60-26-23-56/h1-21,28-30,52-53,55-58H,22-27H2/b47-39-,47-40-,48-41-,48-42-,49-43-,49-45-,50-44-,50-46- |
| InChIKey | VNDKJLIELSIOOY-RGNLWQAKSA-N |
| XLogP | 9.14 |
| TPSA | 165.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.91 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |