C21H21N5O3 — CID 135960848
(5aS,7S)-7-[3-(6-imino-7H-purin-3-yl)prop-1-en-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one (PubChem CID 135960848) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is (5aS,7S)-7-[3-(6-imino-7H-purin-3-yl)prop-1-en-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one.
| Compound Name | (5aS,7S)-7-[3-(6-imino-7H-purin-3-yl)prop-1-en-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one |
|---|---|
| PubChem CID | 135960848 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (5aS,7S)-7-[3-(6-imino-7H-purin-3-yl)prop-1-en-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one |
| SMILES | [H]/N=c1\ncn(CC(=C)[C@H]2CCC3=Cc4c(cc(C)oc4=O)O[C@H]3C2)c2nc[nH]c12 |
| InChI | InChI=1S/C21H21N5O3/c1-11(8-26-10-25-19(22)18-20(26)24-9-23-18)13-3-4-14-6-15-17(29-16(14)7-13)5-12(2)28-21(15)27/h5-6,9-10,13,16,22H,1,3-4,7-8H2,2H3,(H,23,24)/b22-19-/t13-,16-/m0/s1 |
| InChIKey | XDHLXPDDDHIKEC-NTGQDFKTSA-N |
| XLogP | 2.70 |
| TPSA | 109.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|