C48H28MnN4O8+ — CID 135961166
hydroxy-[4-[10,15,20-tris(4-carboxyphenyl)porphyrin-24-id-5-ylidene]cyclohexa-2,5-dien-1-ylidene]methanolate;manganese(3+) (PubChem CID 135961166) has the molecular formula C48H28MnN4O8+ and a molecular weight of 843.71 g/mol. Its IUPAC name is hydroxy-[4-[10,15,20-tris(4-carboxyphenyl)porphyrin-24-id-5-ylidene]cyclohexa-2,5-dien-1-ylidene]methanolate;manganese(3+).
| Compound Name | hydroxy-[4-[10,15,20-tris(4-carboxyphenyl)porphyrin-24-id-5-ylidene]cyclohexa-2,5-dien-1-ylidene]methanolate;manganese(3+) |
|---|---|
| PubChem CID | 135961166 |
| Molecular Formula | C48H28MnN4O8+ |
| Molecular Weight | 843.71 g/mol |
| Exact Mass | 843.13 |
| IUPAC Name | hydroxy-[4-[10,15,20-tris(4-carboxyphenyl)porphyrin-24-id-5-ylidene]cyclohexa-2,5-dien-1-ylidene]methanolate;manganese(3+) |
| SMILES | O=C(O)c1ccc(/C2=C3\C=CC(=N3)C(=c3ccc(=C([O-])O)cc3)C3=N/C(=C(/c4ccc(C(=O)O)cc4)c4ccc([n-]4)/C(c4ccc(C(=O)O)cc4)=C4/C=CC2=N4)C=C3)cc1.[Mn+3] |
| InChI | InChI=1S/C48H30N4O8.Mn/c53-45(54)29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(12-4-26)46(55)56)37-21-23-39(51-37)44(28-7-15-32(16-8-28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(14-6-27)47(57)58;/h1-24H,(H6,49,50,51,52,53,54,55,56,57,58,59,60);/q;+3/p-2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | OAWZTKNCHQQRKF-DAJBKUBHSA-L |
| XLogP | 5.55 |
| TPSA | 206.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |