C20H19F3N4O — CID 135961200
7,7-dimethyl-5-(2,2,2-trifluoroethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one (PubChem CID 135961200) has the molecular formula C20H19F3N4O and a molecular weight of 388.39 g/mol. Its IUPAC name is 7,7-dimethyl-5-(2,2,2-trifluoroethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one.
| Compound Name | 7,7-dimethyl-5-(2,2,2-trifluoroethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
|---|---|
| PubChem CID | 135961200 |
| Molecular Formula | C20H19F3N4O |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 7,7-dimethyl-5-(2,2,2-trifluoroethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
| SMILES | CC1(C)C(=O)N(CC(F)(F)F)c2cc3c4c([nH]c3cc21)-c1[nH]ncc1CCC4 |
| InChI | InChI=1S/C20H19F3N4O/c1-19(2)13-7-14-12(6-15(13)27(18(19)28)9-20(21,22)23)11-5-3-4-10-8-24-26-16(10)17(11)25-14/h6-8,25H,3-5,9H2,1-2H3,(H,24,26) |
| InChIKey | SOGJEMRFZYDVMO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|