C22H23F3N4O — CID 135961207
7,7-dimethyl-5-propan-2-yl-16-(trifluoromethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one (PubChem CID 135961207) has the molecular formula C22H23F3N4O and a molecular weight of 416.45 g/mol. Its IUPAC name is 7,7-dimethyl-5-propan-2-yl-16-(trifluoromethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one.
| Compound Name | 7,7-dimethyl-5-propan-2-yl-16-(trifluoromethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one |
|---|---|
| PubChem CID | 135961207 |
| Molecular Formula | C22H23F3N4O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 7,7-dimethyl-5-propan-2-yl-16-(trifluoromethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one |
| SMILES | CC(C)N1C(=O)C(C)(C)c2cc3[nH]c4c(c3cc21)CCCc1c-4n[nH]c1C(F)(F)F |
| InChI | InChI=1S/C22H23F3N4O/c1-10(2)29-16-8-13-11-6-5-7-12-18(27-28-19(12)22(23,24)25)17(11)26-15(13)9-14(16)21(3,4)20(29)30/h8-10,26H,5-7H2,1-4H3,(H,27,28) |
| InChIKey | WOYCOCLUJBIKAY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|