C25H23FN4O — CID 135961238
(7,7-dimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-5-yl)-(4-fluorophenyl)methanone (PubChem CID 135961238) has the molecular formula C25H23FN4O and a molecular weight of 414.48 g/mol. Its IUPAC name is (7,7-dimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-5-yl)-(4-fluorophenyl)methanone.
| Compound Name | (7,7-dimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-5-yl)-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 135961238 |
| Molecular Formula | C25H23FN4O |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (7,7-dimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-5-yl)-(4-fluorophenyl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccc(F)cc2)c2cc3c4c([nH]c3cc21)-c1[nH]ncc1CCC4 |
| InChI | InChI=1S/C25H23FN4O/c1-25(2)13-30(24(31)14-6-8-16(26)9-7-14)21-10-18-17-5-3-4-15-12-27-29-22(15)23(17)28-20(18)11-19(21)25/h6-12,28H,3-5,13H2,1-2H3,(H,27,29) |
| InChIKey | QDUPBZJMHPCGLJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|